C29H31N3O5 — CID 92657513
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzamide (PubChem CID 92657513) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzamide |
|---|---|
| PubChem CID | 92657513 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc(N3C(=O)N[C@@H]4C[C@@]3(C)Oc3ccc(C)cc34)c2)cc1OC |
| InChI | InChI=1S/C29H31N3O5/c1-18-8-10-24-22(14-18)23-17-29(2,37-24)32(28(34)31-23)21-7-5-6-20(16-21)27(33)30-13-12-19-9-11-25(35-3)26(15-19)36-4/h5-11,14-16,23H,12-13,17H2,1-4H3,(H,30,33)(H,31,34)/t23-,29-/m1/s1 |
| InChIKey | CAQLTARDINQMAX-RNWIMVQKSA-N |
| XLogP | 4.75 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |