C33H31N3O4 — CID 156554956
3-[(1S,9R)-9-methyl-11-oxo-6-phenylmethoxy-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-(2-phenylethyl)benzamide (PubChem CID 156554956) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[(1S,9R)-9-methyl-11-oxo-6-phenylmethoxy-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 3-[(1S,9R)-9-methyl-11-oxo-6-phenylmethoxy-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 156554956 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 3-[(1S,9R)-9-methyl-11-oxo-6-phenylmethoxy-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-(2-phenylethyl)benzamide |
| SMILES | C[C@@]12C[C@H](NC(=O)N1c1cccc(C(=O)NCCc3ccccc3)c1)c1cccc(OCc3ccccc3)c1O2 |
| InChI | InChI=1S/C33H31N3O4/c1-33-21-28(27-16-9-17-29(30(27)40-33)39-22-24-12-6-3-7-13-24)35-32(38)36(33)26-15-8-14-25(20-26)31(37)34-19-18-23-10-4-2-5-11-23/h2-17,20,28H,18-19,21-22H2,1H3,(H,34,37)(H,35,38)/t28-,33+/m0/s1 |
| InChIKey | UNFHROKOVTWCGY-QPQHGXMVSA-N |
| XLogP | 6.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |