C27H28N4O5S — CID 20851841
3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 20851841) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 20851841 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc2c(c1)C1CC(C)(O2)N(c2cccc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)c2)C(=O)N1 |
| InChI | InChI=1S/C27H28N4O5S/c1-17-6-11-24-22(14-17)23-16-27(2,36-24)31(26(33)30-23)20-5-3-4-19(15-20)25(32)29-13-12-18-7-9-21(10-8-18)37(28,34)35/h3-11,14-15,23H,12-13,16H2,1-2H3,(H,29,32)(H,30,33)(H2,28,34,35) |
| InChIKey | UFIIJXJDIWNHHH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |