C29H28N4O3 — CID 92657515
3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 92657515) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 92657515 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-[(1R,9R)-4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | Cc1ccc2c(c1)[C@H]1C[C@@](C)(O2)N(c2cccc(C(=O)NCCc3c[nH]c4ccccc34)c2)C(=O)N1 |
| InChI | InChI=1S/C29H28N4O3/c1-18-10-11-26-23(14-18)25-16-29(2,36-26)33(28(35)32-25)21-7-5-6-19(15-21)27(34)30-13-12-20-17-31-24-9-4-3-8-22(20)24/h3-11,14-15,17,25,31H,12-13,16H2,1-2H3,(H,30,34)(H,32,35)/t25-,29-/m1/s1 |
| InChIKey | WCTQOJIHTWCJEU-VAVYLYDRSA-N |
| XLogP | 5.22 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |