C34H39N3O4 — CID 156534449
3-[6-(cyclohexylmethoxy)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(4-methylphenyl)ethyl]benzamide (PubChem CID 156534449) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-[6-(cyclohexylmethoxy)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 3-[6-(cyclohexylmethoxy)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 156534449 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 3-[6-(cyclohexylmethoxy)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[2-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(CCNC(=O)c2cccc(N3C(=O)NC4CC3(C)Oc3c(OCC5CCCCC5)cccc34)c2)cc1 |
| InChI | InChI=1S/C34H39N3O4/c1-23-14-16-24(17-15-23)18-19-35-32(38)26-10-6-11-27(20-26)37-33(39)36-29-21-34(37,2)41-31-28(29)12-7-13-30(31)40-22-25-8-4-3-5-9-25/h6-7,10-17,20,25,29H,3-5,8-9,18-19,21-22H2,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | OWNQVMQNMSXYEN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |