C17H13ClF2N2O2 — CID 98168181
(1R,9S)-4-chloro-10-(3,4-difluorophenyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 98168181) has the molecular formula C17H13ClF2N2O2 and a molecular weight of 350.75 g/mol. Its IUPAC name is (1R,9S)-4-chloro-10-(3,4-difluorophenyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1R,9S)-4-chloro-10-(3,4-difluorophenyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 98168181 |
| Molecular Formula | C17H13ClF2N2O2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1R,9S)-4-chloro-10-(3,4-difluorophenyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | C[C@]12C[C@@H](NC(=O)N1c1ccc(F)c(F)c1)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C17H13ClF2N2O2/c1-17-8-14(11-6-9(18)2-5-15(11)24-17)21-16(23)22(17)10-3-4-12(19)13(20)7-10/h2-7,14H,8H2,1H3,(H,21,23)/t14-,17+/m1/s1 |
| InChIKey | CIIOONITOBHYGF-PBHICJAKSA-N |
| XLogP | 4.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |