C19H12Cl2N2O5 — CID 98326993
(3aS,6aS)-3-(2,4-dichlorophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98326993) has the molecular formula C19H12Cl2N2O5 and a molecular weight of 419.22 g/mol. Its IUPAC name is (3aS,6aS)-3-(2,4-dichlorophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aS)-3-(2,4-dichlorophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98326993 |
| Molecular Formula | C19H12Cl2N2O5 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (3aS,6aS)-3-(2,4-dichlorophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@H]2C(c3ccc(Cl)cc3Cl)=NO[C@@H]2C(=O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H12Cl2N2O5/c20-9-1-3-11(12(21)7-9)16-15-17(28-22-16)19(25)23(18(15)24)10-2-4-13-14(8-10)27-6-5-26-13/h1-4,7-8,15,17H,5-6H2/t15-,17-/m0/s1 |
| InChIKey | VMNOQPPQVXIYII-RDJZCZTQSA-N |
| XLogP | 3.06 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|