C16H13ClN4O3 — CID 98195532
(3aS,6aS)-5-(4-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98195532) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is (3aS,6aS)-5-(4-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aS)-5-(4-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98195532 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (3aS,6aS)-5-(4-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1nn(C)cc1C1=NO[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H13ClN4O3/c1-8-11(7-20(2)18-8)13-12-14(24-19-13)16(23)21(15(12)22)10-5-3-9(17)4-6-10/h3-7,12,14H,1-2H3/t12-,14-/m0/s1 |
| InChIKey | DYIUTIGOPBOTGM-JSGCOSHPSA-N |
| XLogP | 1.67 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|