C23H12Cl4F3NO2 — CID 53233695
4,5,6,7-tetrachloro-2-[3-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]isoindole-1,3-dione (PubChem CID 53233695) has the molecular formula C23H12Cl4F3NO2 and a molecular weight of 533.16 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[3-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[3-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53233695 |
| Molecular Formula | C23H12Cl4F3NO2 |
| Molecular Weight | 533.16 g/mol |
| Exact Mass | 530.96 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[3-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1c1cccc(CCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H12Cl4F3NO2/c24-17-15-16(18(25)20(27)19(17)26)22(33)31(21(15)32)14-6-2-4-12(10-14)8-7-11-3-1-5-13(9-11)23(28,29)30/h1-6,9-10H,7-8H2 |
| InChIKey | LAPAHPFWGCGISY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.16 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|