C14H11ClF3NO — CID 129453025
4-chloro-6-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one (PubChem CID 129453025) has the molecular formula C14H11ClF3NO and a molecular weight of 301.70 g/mol. Its IUPAC name is 4-chloro-6-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one.
| Compound Name | 4-chloro-6-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 129453025 |
| Molecular Formula | C14H11ClF3NO |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-chloro-6-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one |
| SMILES | Cc1cc(Cl)cc(=O)n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11ClF3NO/c1-9-5-12(15)7-13(20)19(9)8-10-3-2-4-11(6-10)14(16,17)18/h2-7H,8H2,1H3 |
| InChIKey | KTOCNDKUCBBHIY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |