C26H19ClF3N3O4 — CID 1408344
2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 1408344) has the molecular formula C26H19ClF3N3O4 and a molecular weight of 529.90 g/mol. Its IUPAC name is 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1408344 |
| Molecular Formula | C26H19ClF3N3O4 |
| Molecular Weight | 529.90 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(NC3=C(Cl)C(=O)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H19ClF3N3O4/c1-37-20-11-9-17(10-12-20)31-21(34)13-15-5-7-18(8-6-15)32-23-22(27)24(35)33(25(23)36)19-4-2-3-16(14-19)26(28,29)30/h2-12,14,32H,13H2,1H3,(H,31,34) |
| InChIKey | HBGBWAKGOAGOEC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|