C26H18ClF3N4O4 — CID 1408357
4-[[2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]acetyl]amino]benzamide (PubChem CID 1408357) has the molecular formula C26H18ClF3N4O4 and a molecular weight of 542.90 g/mol. Its IUPAC name is 4-[[2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 1408357 |
| Molecular Formula | C26H18ClF3N4O4 |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 4-[[2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)Cc2ccc(NC3=C(Cl)C(=O)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H18ClF3N4O4/c27-21-22(25(38)34(24(21)37)19-3-1-2-16(13-19)26(28,29)30)33-18-8-4-14(5-9-18)12-20(35)32-17-10-6-15(7-11-17)23(31)36/h1-11,13,33H,12H2,(H2,31,36)(H,32,35) |
| InChIKey | SUUNCFCPIRKOCK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|