C19H16ClF3N2O2 — CID 113188634
N-[(4-chlorophenyl)methyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 113188634) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113188634 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CC(=O)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c20-15-6-4-12(5-7-15)10-24-18(27)13-8-17(26)25(11-13)16-3-1-2-14(9-16)19(21,22)23/h1-7,9,13H,8,10-11H2,(H,24,27) |
| InChIKey | PPBCBILSUZVHPR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |