C20H22ClN3O2 — CID 46581333
1-(3-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 46581333) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46581333 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CC(=O)N(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-23(2)17-8-6-14(7-9-17)12-22-20(26)15-10-19(25)24(13-15)18-5-3-4-16(21)11-18/h3-9,11,15H,10,12-13H2,1-2H3,(H,22,26) |
| InChIKey | LRIRBFHKGYWJDL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|