C19H17ClN2O2 — CID 719758
3-chloro-4-(4-ethylanilino)-1-(3-methylphenyl)pyrrole-2,5-dione (PubChem CID 719758) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-chloro-4-(4-ethylanilino)-1-(3-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-ethylanilino)-1-(3-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 719758 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-chloro-4-(4-ethylanilino)-1-(3-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCc1ccc(NC2=C(Cl)C(=O)N(c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O2/c1-3-13-7-9-14(10-8-13)21-17-16(20)18(23)22(19(17)24)15-6-4-5-12(2)11-15/h4-11,21H,3H2,1-2H3 |
| InChIKey | AANSTWYPUPAALT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|