C22H17Cl2N5O4S — CID 6405623
4-[[4-chloro-1-(4-ethylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(6-chloropyridazin-3-yl)benzenesulfonamide (PubChem CID 6405623) has the molecular formula C22H17Cl2N5O4S and a molecular weight of 518.38 g/mol. Its IUPAC name is 4-[[4-chloro-1-(4-ethylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(6-chloropyridazin-3-yl)benzenesulfonamide.
| Compound Name | 4-[[4-chloro-1-(4-ethylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(6-chloropyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 6405623 |
| Molecular Formula | C22H17Cl2N5O4S |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 4-[[4-chloro-1-(4-ethylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(6-chloropyridazin-3-yl)benzenesulfonamide |
| SMILES | CCc1ccc(N2C(=O)C(Cl)=C(Nc3ccc(S(=O)(=O)Nc4ccc(Cl)nn4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O4S/c1-2-13-3-7-15(8-4-13)29-21(30)19(24)20(22(29)31)25-14-5-9-16(10-6-14)34(32,33)28-18-12-11-17(23)26-27-18/h3-12,25H,2H2,1H3,(H,27,28) |
| InChIKey | XGEQORZJXMFPTC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|