C18H11ClN4O2 — CID 168518113
2-[4-[(6-chloropyridazin-3-yl)amino]phenyl]isoindole-1,3-dione (PubChem CID 168518113) has the molecular formula C18H11ClN4O2 and a molecular weight of 350.77 g/mol. Its IUPAC name is 2-[4-[(6-chloropyridazin-3-yl)amino]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(6-chloropyridazin-3-yl)amino]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518113 |
| Molecular Formula | C18H11ClN4O2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[4-[(6-chloropyridazin-3-yl)amino]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C18H11ClN4O2/c19-15-9-10-16(22-21-15)20-11-5-7-12(8-6-11)23-17(24)13-3-1-2-4-14(13)18(23)25/h1-10H,(H,20,22) |
| InChIKey | GVPZNXQEANIJML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|