C21H19N5O2 — CID 168519001
2-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]isoindole-1,3-dione (PubChem CID 168519001) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519001 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N(C)C)nc(Nc2ccc(N3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C21H19N5O2/c1-13-12-18(25(2)3)24-21(22-13)23-14-8-10-15(11-9-14)26-19(27)16-6-4-5-7-17(16)20(26)28/h4-12H,1-3H3,(H,22,23,24) |
| InChIKey | CMHRLSZWSUTCRU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|