C25H21ClN2O5 — CID 110595150
1-(3-chloro-4-methoxyphenyl)-3-(2,5-dimethoxyanilino)-4-phenylpyrrole-2,5-dione (PubChem CID 110595150) has the molecular formula C25H21ClN2O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(2,5-dimethoxyanilino)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(2,5-dimethoxyanilino)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595150 |
| Molecular Formula | C25H21ClN2O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(2,5-dimethoxyanilino)-4-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(OC)c(NC2=C(c3ccccc3)C(=O)N(c3ccc(OC)c(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C25H21ClN2O5/c1-31-17-10-12-21(33-3)19(14-17)27-23-22(15-7-5-4-6-8-15)24(29)28(25(23)30)16-9-11-20(32-2)18(26)13-16/h4-14,27H,1-3H3 |
| InChIKey | WMNOMNVQVPVKKP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|