C24H18ClFN2O4 — CID 110587083
1-(3-chlorophenyl)-3-(2,5-dimethoxyanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110587083) has the molecular formula C24H18ClFN2O4 and a molecular weight of 452.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,5-dimethoxyanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-(2,5-dimethoxyanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587083 |
| Molecular Formula | C24H18ClFN2O4 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,5-dimethoxyanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(OC)c(NC2=C(c3ccc(F)cc3)C(=O)N(c3cccc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C24H18ClFN2O4/c1-31-18-10-11-20(32-2)19(13-18)27-22-21(14-6-8-16(26)9-7-14)23(29)28(24(22)30)17-5-3-4-15(25)12-17/h3-13,27H,1-2H3 |
| InChIKey | YQCCZCXONIABKW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|