C20H11Cl2NO2 — CID 137274049
10-(2,4-dichlorophenyl)imino-4-hydroxyanthracen-9-one (PubChem CID 137274049) has the molecular formula C20H11Cl2NO2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 10-(2,4-dichlorophenyl)imino-4-hydroxyanthracen-9-one.
| Compound Name | 10-(2,4-dichlorophenyl)imino-4-hydroxyanthracen-9-one |
|---|---|
| PubChem CID | 137274049 |
| Molecular Formula | C20H11Cl2NO2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 10-(2,4-dichlorophenyl)imino-4-hydroxyanthracen-9-one |
| SMILES | O=C1c2ccccc2/C(=N\c2ccc(Cl)cc2Cl)c2c(O)cccc21 |
| InChI | InChI=1S/C20H11Cl2NO2/c21-11-8-9-16(15(22)10-11)23-19-12-4-1-2-5-13(12)20(25)14-6-3-7-17(24)18(14)19/h1-10,24H/b23-19+ |
| InChIKey | PZEBUNQMMQOYQU-FCDQGJHFSA-N |
| XLogP | 5.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|