C28H30N4O3 — CID 135585790
5,6-dimethoxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol (PubChem CID 135585790) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5,6-dimethoxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135585790 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 5,6-dimethoxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
| SMILES | COc1cc2[nH]c(O)c(/C(=N/c3ccc(N4CCN(C)CC4)cc3)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C28H30N4O3/c1-31-13-15-32(16-14-31)21-11-9-20(10-12-21)29-27(19-7-5-4-6-8-19)26-22-17-24(34-2)25(35-3)18-23(22)30-28(26)33/h4-12,17-18,30,33H,13-16H2,1-3H3/b29-27+ |
| InChIKey | OWUXTLUXDXVETH-ORIPQNMZSA-N |
| XLogP | 4.81 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|