C28H28N4O3 — CID 135492840
2-hydroxy-3-[N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid (PubChem CID 135492840) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-hydroxy-3-[N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid.
| Compound Name | 2-hydroxy-3-[N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 135492840 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-hydroxy-3-[N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid |
| SMILES | CN1CCN(Cc2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(C(=O)O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C28H28N4O3/c1-31-13-15-32(16-14-31)18-19-7-10-22(11-8-19)29-26(20-5-3-2-4-6-20)25-23-12-9-21(28(34)35)17-24(23)30-27(25)33/h2-12,17,30,33H,13-16,18H2,1H3,(H,34,35)/b29-26+ |
| InChIKey | UNJYQHZAGBKXLD-PBBVDAKRSA-N |
| XLogP | 4.49 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|