C28H30BN5O4 — CID 171641930
[2-hydroxy-3-[N-[4-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indol-6-yl]boronic acid (PubChem CID 171641930) has the molecular formula C28H30BN5O4 and a molecular weight of 511.39 g/mol. Its IUPAC name is [2-hydroxy-3-[N-[4-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indol-6-yl]boronic acid.
| Compound Name | [2-hydroxy-3-[N-[4-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indol-6-yl]boronic acid |
|---|---|
| PubChem CID | 171641930 |
| Molecular Formula | C28H30BN5O4 |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | [2-hydroxy-3-[N-[4-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indol-6-yl]boronic acid |
| SMILES | CN1CCN(CC(=O)Nc2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(B(O)O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C28H30BN5O4/c1-33-13-15-34(16-14-33)18-25(35)30-21-8-10-22(11-9-21)31-27(19-5-3-2-4-6-19)26-23-12-7-20(29(37)38)17-24(23)32-28(26)36/h2-12,17,32,36-38H,13-16,18H2,1H3,(H,30,35)/b31-27+ |
| InChIKey | AOOKBZOQLSWCJH-TVKQRKNISA-N |
| XLogP | 1.91 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|