C31H33N5O2 — CID 136592418
N-cyclobutyl-2-hydroxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxamide (PubChem CID 136592418) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-cyclobutyl-2-hydroxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxamide.
| Compound Name | N-cyclobutyl-2-hydroxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 136592418 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-cyclobutyl-2-hydroxy-3-[N-[4-(4-methylpiperazin-1-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxamide |
| SMILES | CN1CCN(c2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(C(=O)NC5CCC5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C31H33N5O2/c1-35-16-18-36(19-17-35)25-13-11-24(12-14-25)32-29(21-6-3-2-4-7-21)28-26-15-10-22(20-27(26)34-31(28)38)30(37)33-23-8-5-9-23/h2-4,6-7,10-15,20,23,34,38H,5,8-9,16-19H2,1H3,(H,33,37)/b32-29+ |
| InChIKey | MKMRXTQEACOWFK-UUDCSCGESA-N |
| XLogP | 5.08 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|