C30H30FN5O5 — CID 137199928
3-[N-[3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylic acid (PubChem CID 137199928) has the molecular formula C30H30FN5O5 and a molecular weight of 559.60 g/mol. Its IUPAC name is 3-[N-[3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylic acid.
| Compound Name | 3-[N-[3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 137199928 |
| Molecular Formula | C30H30FN5O5 |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 3-[N-[3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylic acid |
| SMILES | CN1CCN(CCONC(=O)c2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(C(=O)O)ccc34)cc2F)CC1 |
| InChI | InChI=1S/C30H30FN5O5/c1-35-11-13-36(14-12-35)15-16-41-34-28(37)22-10-8-21(18-24(22)31)32-27(19-5-3-2-4-6-19)26-23-9-7-20(30(39)40)17-25(23)33-29(26)38/h2-10,17-18,33,38H,11-16H2,1H3,(H,34,37)(H,39,40)/b32-27+ |
| InChIKey | YZICJPTXAIKGRU-QVAGMWBUSA-N |
| XLogP | 3.79 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|