C34H38N6O6 — CID 137209201
methyl 2-hydroxy-5-methyl-3-[N-[4-[2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate (PubChem CID 137209201) has the molecular formula C34H38N6O6 and a molecular weight of 626.71 g/mol. Its IUPAC name is methyl 2-hydroxy-5-methyl-3-[N-[4-[2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate.
| Compound Name | methyl 2-hydroxy-5-methyl-3-[N-[4-[2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 137209201 |
| Molecular Formula | C34H38N6O6 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | methyl 2-hydroxy-5-methyl-3-[N-[4-[2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
| SMILES | CNC(=O)CN1CCN(CCONC(=O)c2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(C(=O)OC)c(C)cc34)cc2)CC1 |
| InChI | InChI=1S/C34H38N6O6/c1-22-19-27-28(20-26(22)34(44)45-3)37-33(43)30(27)31(23-7-5-4-6-8-23)36-25-11-9-24(10-12-25)32(42)38-46-18-17-39-13-15-40(16-14-39)21-29(41)35-2/h4-12,19-20,37,43H,13-18,21H2,1-3H3,(H,35,41)(H,38,42)/b36-31+ |
| InChIKey | HDFIESXNNYXTPI-XKMRCYARSA-N |
| XLogP | 3.16 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|