C29H30N4O5 — CID 137209159
methyl 3-[N-[4-[2-(dimethylamino)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate (PubChem CID 137209159) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is methyl 3-[N-[4-[2-(dimethylamino)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[2-(dimethylamino)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 137209159 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | methyl 3-[N-[4-[2-(dimethylamino)ethoxycarbamoyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1cc2[nH]c(O)c(/C(=N/c3ccc(C(=O)NOCCN(C)C)cc3)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C29H30N4O5/c1-18-16-23-24(17-22(18)29(36)37-4)31-28(35)25(23)26(19-8-6-5-7-9-19)30-21-12-10-20(11-13-21)27(34)32-38-15-14-33(2)3/h5-13,16-17,31,35H,14-15H2,1-4H3,(H,32,34)/b30-26+ |
| InChIKey | FXXSUBWIEWAZJN-URGPHPNLSA-N |
| XLogP | 4.36 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|