C34H34N4O5 — CID 158109701
methyl 3-[N-[4-[2-[2-(4-cyanopiperidin-1-yl)ethoxy]acetyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate (PubChem CID 158109701) has the molecular formula C34H34N4O5 and a molecular weight of 578.67 g/mol. Its IUPAC name is methyl 3-[N-[4-[2-[2-(4-cyanopiperidin-1-yl)ethoxy]acetyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[2-[2-(4-cyanopiperidin-1-yl)ethoxy]acetyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 158109701 |
| Molecular Formula | C34H34N4O5 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | methyl 3-[N-[4-[2-[2-(4-cyanopiperidin-1-yl)ethoxy]acetyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-5-methyl-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1cc2[nH]c(O)c(/C(=N/c3ccc(C(=O)COCCN4CCC(C#N)CC4)cc3)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C34H34N4O5/c1-22-18-28-29(19-27(22)34(41)42-2)37-33(40)31(28)32(25-6-4-3-5-7-25)36-26-10-8-24(9-11-26)30(39)21-43-17-16-38-14-12-23(20-35)13-15-38/h3-11,18-19,23,37,40H,12-17,21H2,1-2H3/b36-32+ |
| InChIKey | KIANWPIMMMOBBT-WIKZRCHHSA-N |
| XLogP | 5.57 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|