C28H29N3O — CID 135622147
5-methyl-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indol-2-ol (PubChem CID 135622147) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-methyl-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5-methyl-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135622147 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 5-methyl-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indol-2-ol |
| SMILES | Cc1ccc2[nH]c(O)c(/C(=N/c3ccc(CN4CCCCC4)cc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C28H29N3O/c1-20-10-15-25-24(18-20)26(28(32)30-25)27(22-8-4-2-5-9-22)29-23-13-11-21(12-14-23)19-31-16-6-3-7-17-31/h2,4-5,8-15,18,30,32H,3,6-7,16-17,19H2,1H3/b29-27+ |
| InChIKey | QNXJWNFYUJZTGQ-ORIPQNMZSA-N |
| XLogP | 6.34 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|