C30H28N4OS — CID 177186112
3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-(1,3-thiazol-4-yl)-1H-indol-2-ol (PubChem CID 177186112) has the molecular formula C30H28N4OS and a molecular weight of 492.65 g/mol. Its IUPAC name is 3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-(1,3-thiazol-4-yl)-1H-indol-2-ol.
| Compound Name | 3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-(1,3-thiazol-4-yl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 177186112 |
| Molecular Formula | C30H28N4OS |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-(1,3-thiazol-4-yl)-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(-c3cscn3)cc2c1/C(=N/c1ccc(CN2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N4OS/c35-30-28(25-17-23(11-14-26(25)33-30)27-19-36-20-31-27)29(22-7-3-1-4-8-22)32-24-12-9-21(10-13-24)18-34-15-5-2-6-16-34/h1,3-4,7-14,17,19-20,33,35H,2,5-6,15-16,18H2/b32-29+ |
| InChIKey | LGUSZFLECKFSPD-UUDCSCGESA-N |
| XLogP | 7.15 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|