C25H23N3O4S — CID 137046586
2-hydroxy-3-[N-[4-(morpholin-4-ylmethyl)phenyl]-C-thiophen-3-ylcarbonimidoyl]-1H-indole-5-carboxylic acid (PubChem CID 137046586) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-hydroxy-3-[N-[4-(morpholin-4-ylmethyl)phenyl]-C-thiophen-3-ylcarbonimidoyl]-1H-indole-5-carboxylic acid.
| Compound Name | 2-hydroxy-3-[N-[4-(morpholin-4-ylmethyl)phenyl]-C-thiophen-3-ylcarbonimidoyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 137046586 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-hydroxy-3-[N-[4-(morpholin-4-ylmethyl)phenyl]-C-thiophen-3-ylcarbonimidoyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c(O)c(/C(=N/c3ccc(CN4CCOCC4)cc3)c3ccsc3)c2c1 |
| InChI | InChI=1S/C25H23N3O4S/c29-24-22(20-13-17(25(30)31)3-6-21(20)27-24)23(18-7-12-33-15-18)26-19-4-1-16(2-5-19)14-28-8-10-32-11-9-28/h1-7,12-13,15,27,29H,8-11,14H2,(H,30,31)/b26-23+ |
| InChIKey | AYTYYWIRPLUXJJ-WNAAXNPUSA-N |
| XLogP | 4.63 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|