C31H24FN3O3S — CID 135985476
3-(C,N-diphenylcarbonimidoyl)-5-(4-fluorophenyl)sulfonyl-6-[3-(methylamino)prop-1-ynyl]-1H-indol-2-ol (PubChem CID 135985476) has the molecular formula C31H24FN3O3S and a molecular weight of 537.62 g/mol. Its IUPAC name is 3-(C,N-diphenylcarbonimidoyl)-5-(4-fluorophenyl)sulfonyl-6-[3-(methylamino)prop-1-ynyl]-1H-indol-2-ol.
| Compound Name | 3-(C,N-diphenylcarbonimidoyl)-5-(4-fluorophenyl)sulfonyl-6-[3-(methylamino)prop-1-ynyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135985476 |
| Molecular Formula | C31H24FN3O3S |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 3-(C,N-diphenylcarbonimidoyl)-5-(4-fluorophenyl)sulfonyl-6-[3-(methylamino)prop-1-ynyl]-1H-indol-2-ol |
| SMILES | CNCC#Cc1cc2[nH]c(O)c(/C(=N/c3ccccc3)c3ccccc3)c2cc1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H24FN3O3S/c1-33-18-8-11-22-19-27-26(20-28(22)39(37,38)25-16-14-23(32)15-17-25)29(31(36)35-27)30(21-9-4-2-5-10-21)34-24-12-6-3-7-13-24/h2-7,9-10,12-17,19-20,33,35-36H,18H2,1H3/b34-30+ |
| InChIKey | NWSSCLPCYLCLNH-VBMGMRCRSA-N |
| XLogP | 5.59 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|