C7H6N2NaO3S2 — CID 87440043
CID 87440043 (PubChem CID 87440043) has the molecular formula C7H6N2NaO3S2 and a molecular weight of 253.26 g/mol.
| Compound Name | CID 87440043 |
|---|---|
| PubChem CID | 87440043 |
| Molecular Formula | C7H6N2NaO3S2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2[nH]c(=S)[nH]c2c1.[Na] |
| InChI | InChI=1S/C7H6N2O3S2.Na/c10-14(11,12)4-1-2-5-6(3-4)9-7(13)8-5;/h1-3H,(H2,8,9,13)(H,10,11,12); |
| InChIKey | DUYMOPPDMCTXNS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|