About 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid
2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (PubChem CID 703333) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| PubChem CID | 703333 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C8H6N2O2S/c11-7(12)4-1-2-5-6(3-4)10-8(13)9-5/h1-3H,(H,11,12)(H2,9,10,13) |
| InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid?
The IUPAC name of 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (CID 703333) is 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid?
The canonical SMILES for 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid is O=C(O)c1ccc2[nH]c(=S)[nH]c2c1.
What is the InChIKey of 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid?
The InChIKey is DCRZVUIGGYMOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-7(12)4-1-2-5-6(3-4)10-8(13)9-5/h1-3H,(H,11,12)(H2,9,10,13).
What are the key properties of 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid?
2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid has a molecular weight of 194.22 g/mol, XLogP of 1.92, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid is sourced from PubChem (CID 703333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).