C16H9N2O8S2- — CID 135972130
[2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-3-oxoindol-5-yl] sulfite (PubChem CID 135972130) has the molecular formula C16H9N2O8S2- and a molecular weight of 421.39 g/mol. Its IUPAC name is [2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-3-oxoindol-5-yl] sulfite.
| Compound Name | [2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-3-oxoindol-5-yl] sulfite |
|---|---|
| PubChem CID | 135972130 |
| Molecular Formula | C16H9N2O8S2- |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | [2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-3-oxoindol-5-yl] sulfite |
| SMILES | O=C1C(c2[nH]c3ccc(S(=O)(=O)O)cc3c2O)=Nc2ccc(OS(=O)[O-])cc21 |
| InChI | InChI=1S/C16H10N2O8S2/c19-15-9-5-7(26-27(21)22)1-3-11(9)17-13(15)14-16(20)10-6-8(28(23,24)25)2-4-12(10)18-14/h1-6,18,20H,(H,21,22)(H,23,24,25)/p-1 |
| InChIKey | OQSDPSTUEOMXHL-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|