C26H18N5NaO3S — CID 135666596
sodium 4-[[4-[(2-phenyl-1H-indol-3-yl)diazenyl]phenyl]diazenyl]benzenesulfonate (PubChem CID 135666596) has the molecular formula C26H18N5NaO3S and a molecular weight of 503.52 g/mol. Its IUPAC name is sodium 4-[[4-[(2-phenyl-1H-indol-3-yl)diazenyl]phenyl]diazenyl]benzenesulfonate.
| Compound Name | sodium 4-[[4-[(2-phenyl-1H-indol-3-yl)diazenyl]phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 135666596 |
| Molecular Formula | C26H18N5NaO3S |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | sodium 4-[[4-[(2-phenyl-1H-indol-3-yl)diazenyl]phenyl]diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(/N=N/c3c(-c4ccccc4)[nH]c4ccccc34)cc2)cc1.[Na+] |
| InChI | InChI=1S/C26H19N5O3S.Na/c32-35(33,34)22-16-14-21(15-17-22)29-28-19-10-12-20(13-11-19)30-31-26-23-8-4-5-9-24(23)27-25(26)18-6-2-1-3-7-18;/h1-17,27H,(H,32,33,34);/q;+1/p-1/b29-28+,31-30+; |
| InChIKey | MYQSVLROTCOCBD-BBEMJUQRSA-M |
| XLogP | 4.57 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|