C21H15N4NaO5S — CID 135568354
sodium 4-[(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)diazenyl]benzenesulfonate (PubChem CID 135568354) has the molecular formula C21H15N4NaO5S and a molecular weight of 458.43 g/mol. Its IUPAC name is sodium 4-[(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)diazenyl]benzenesulfonate.
| Compound Name | sodium 4-[(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 135568354 |
| Molecular Formula | C21H15N4NaO5S |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | sodium 4-[(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)diazenyl]benzenesulfonate |
| SMILES | O=c1c(/N=N/c2ccc(S(=O)(=O)[O-])cc2)c(O)n(-c2ccccc2)n1-c1ccccc1.[Na+] |
| InChI | InChI=1S/C21H16N4O5S.Na/c26-20-19(23-22-15-11-13-18(14-12-15)31(28,29)30)21(27)25(17-9-5-2-6-10-17)24(20)16-7-3-1-4-8-16;/h1-14,26H,(H,28,29,30);/q;+1/p-1/b23-22+; |
| InChIKey | JLOMTRAXUNCQJR-PGCQSHBKSA-M |
| XLogP | 0.66 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|