C19H27N5O2S — CID 135733362
1-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 135733362) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 135733362 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CC(C)c1ccc2[nH]c(O)c(/N=N/C(=S)NCCCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C19H27N5O2S/c1-13(2)14-4-5-16-15(12-14)17(18(25)21-16)22-23-19(27)20-6-3-7-24-8-10-26-11-9-24/h4-5,12-13,21,25H,3,6-11H2,1-2H3,(H,20,27)/b23-22+ |
| InChIKey | KOWNNLGXFGPHFI-GHVJWSGMSA-N |
| XLogP | 3.68 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|