C15H19FN5O2S+ — CID 135612456
1-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 135612456) has the molecular formula C15H19FN5O2S+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135612456 |
| Molecular Formula | C15H19FN5O2S+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Oc1[nH]c2ccc(F)cc2c1/N=N/C(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H18FN5O2S/c16-10-1-2-12-11(9-10)13(14(22)18-12)19-20-15(24)17-3-4-21-5-7-23-8-6-21/h1-2,9,18,22H,3-8H2,(H,17,24)/p+1/b20-19+ |
| InChIKey | HAAPPRPKUNXTBR-FMQUCBEESA-O |
| XLogP | 0.89 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|