C14H7Cl3FN3O — CID 135775190
5-fluoro-3-[(2,4,6-trichlorophenyl)diazenyl]-1H-indol-2-ol (PubChem CID 135775190) has the molecular formula C14H7Cl3FN3O and a molecular weight of 358.59 g/mol. Its IUPAC name is 5-fluoro-3-[(2,4,6-trichlorophenyl)diazenyl]-1H-indol-2-ol.
| Compound Name | 5-fluoro-3-[(2,4,6-trichlorophenyl)diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135775190 |
| Molecular Formula | C14H7Cl3FN3O |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 5-fluoro-3-[(2,4,6-trichlorophenyl)diazenyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(F)cc2c1/N=N/c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H7Cl3FN3O/c15-6-3-9(16)13(10(17)4-6)21-20-12-8-5-7(18)1-2-11(8)19-14(12)22/h1-5,19,22H/b21-20+ |
| InChIKey | PPWXLSMFPXMWTO-QZQOTICOSA-N |
| XLogP | 6.39 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|