C16H22FN4OS+ — CID 2471736
1-(2-cyanoethyl)-1-(4-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 2471736) has the molecular formula C16H22FN4OS+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-(4-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(2-cyanoethyl)-1-(4-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 2471736 |
| Molecular Formula | C16H22FN4OS+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(2-cyanoethyl)-1-(4-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | N#CCCN(C(=S)NCC[NH+]1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN4OS/c17-14-2-4-15(5-3-14)21(8-1-6-18)16(23)19-7-9-20-10-12-22-13-11-20/h2-5H,1,7-13H2,(H,19,23)/p+1 |
| InChIKey | CRCHCIWPZBWUPP-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|