C19H27N6O3S+ — CID 9093549
1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-1-methyl-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 9093549) has the molecular formula C19H27N6O3S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-1-methyl-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-1-methyl-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9093549 |
| Molecular Formula | C19H27N6O3S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-1-methyl-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CN(C(=S)NCC[NH+]1CCOCC1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N6O3S/c1-23(19(29)21-7-8-24-9-11-28-12-10-24)15-16(20)25(18(27)22-17(15)26)13-14-5-3-2-4-6-14/h2-6H,7-13,20H2,1H3,(H,21,29)(H,22,26,27)/p+1 |
| InChIKey | SPRNPHFCRUKZLU-UHFFFAOYSA-O |
| XLogP | -1.61 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|