C24H29N5O3 — CID 60575810
6-amino-1-benzyl-5-[benzyl(2-morpholin-4-ylethyl)amino]pyrimidine-2,4-dione (PubChem CID 60575810) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[benzyl(2-morpholin-4-ylethyl)amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[benzyl(2-morpholin-4-ylethyl)amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60575810 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 6-amino-1-benzyl-5-[benzyl(2-morpholin-4-ylethyl)amino]pyrimidine-2,4-dione |
| SMILES | Nc1c(N(CCN2CCOCC2)Cc2ccccc2)c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H29N5O3/c25-22-21(23(30)26-24(31)29(22)18-20-9-5-2-6-10-20)28(17-19-7-3-1-4-8-19)12-11-27-13-15-32-16-14-27/h1-10H,11-18,25H2,(H,26,30,31) |
| InChIKey | SFTHWSRUNCOHMA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |