C25H23N5O4 — CID 34646790
6-amino-1-benzyl-5-[benzyl-[(2-nitrophenyl)methyl]amino]pyrimidine-2,4-dione (PubChem CID 34646790) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[benzyl-[(2-nitrophenyl)methyl]amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[benzyl-[(2-nitrophenyl)methyl]amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 34646790 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 6-amino-1-benzyl-5-[benzyl-[(2-nitrophenyl)methyl]amino]pyrimidine-2,4-dione |
| SMILES | Nc1c(N(Cc2ccccc2)Cc2ccccc2[N+](=O)[O-])c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23N5O4/c26-23-22(24(31)27-25(32)29(23)16-19-11-5-2-6-12-19)28(15-18-9-3-1-4-10-18)17-20-13-7-8-14-21(20)30(33)34/h1-14H,15-17,26H2,(H,27,31,32) |
| InChIKey | WRYDUPCCQBTDKS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|