About 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide
4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide (PubChem CID 30871134) has the molecular formula C23H26N6O5
and a molecular weight of 466.50 g/mol. Its IUPAC name is 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide.
Molecular Properties
| Compound Name | 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide |
| PubChem CID | 30871134 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)Cc2ccc(C(N)=O)cc2[N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H26N6O5/c1-2-3-11-28-20(24)19(22(31)26-23(28)32)27(13-15-7-5-4-6-8-15)14-17-10-9-16(21(25)30)12-18(17)29(33)34/h4-10,12H,2-3,11,13-14,24H2,1H3,(H2,25,30)(H,26,31,32) |
| InChIKey | HRJLEMBOYMTALN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide?
The IUPAC name of 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide (CID 30871134) is 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide.
What is the SMILES notation for 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide?
The canonical SMILES for 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide is CCCCn1c(N)c(N(Cc2ccccc2)Cc2ccc(C(N)=O)cc2[N+](=O)[O-])c(=O)[nH]c1=O.
What is the InChIKey of 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide?
The InChIKey is HRJLEMBOYMTALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N6O5/c1-2-3-11-28-20(24)19(22(31)26-23(28)32)27(13-15-7-5-4-6-8-15)14-17-10-9-16(21(25)30)12-18(17)29(33)34/h4-10,12H,2-3,11,13-14,24H2,1H3,(H2,25,30)(H,26,31,32).
What are the key properties of 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide?
4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide has a molecular weight of 466.50 g/mol, XLogP of 2.13, 10 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide is sourced from PubChem (CID 30871134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).