C23H26N6O5 — CID 30871134
4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide (PubChem CID 30871134) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide.
| Compound Name | 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 30871134 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylamino]methyl]-3-nitrobenzamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)Cc2ccc(C(N)=O)cc2[N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H26N6O5/c1-2-3-11-28-20(24)19(22(31)26-23(28)32)27(13-15-7-5-4-6-8-15)14-17-10-9-16(21(25)30)12-18(17)29(33)34/h4-10,12H,2-3,11,13-14,24H2,1H3,(H2,25,30)(H,26,31,32) |
| InChIKey | HRJLEMBOYMTALN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|