C22H21N5O5 — CID 26176034
(E)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 26176034) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is (E)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26176034 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (E)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1ccccc1[N+](=O)[O-])c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H21N5O5/c1-2-25(18(28)13-12-16-10-6-7-11-17(16)27(31)32)19-20(23)26(22(30)24-21(19)29)14-15-8-4-3-5-9-15/h3-13H,2,14,23H2,1H3,(H,24,29,30)/b13-12+ |
| InChIKey | UIMIXIAYTIHNSC-OUKQBFOZSA-N |
| XLogP | 2.14 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|