C21H22N6O5 — CID 16963220
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-(methylamino)-5-nitrobenzamide (PubChem CID 16963220) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963220 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-(methylamino)-5-nitrobenzamide |
| SMILES | CCN(C(=O)c1cc([N+](=O)[O-])ccc1NC)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H22N6O5/c1-3-25(20(29)15-11-14(27(31)32)9-10-16(15)23-2)17-18(22)26(21(30)24-19(17)28)12-13-7-5-4-6-8-13/h4-11,23H,3,12,22H2,1-2H3,(H,24,28,30) |
| InChIKey | NFPFGSVKMLPUMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|