C23H26N6O5 — CID 26416728
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(3-nitroanilino)acetamide (PubChem CID 26416728) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(3-nitroanilino)acetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 26416728 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(3-nitroanilino)acetamide |
| SMILES | CCCCN(C(=O)CNc1cccc([N+](=O)[O-])c1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H26N6O5/c1-2-3-12-27(19(30)14-25-17-10-7-11-18(13-17)29(33)34)20-21(24)28(23(32)26-22(20)31)15-16-8-5-4-6-9-16/h4-11,13,25H,2-3,12,14-15,24H2,1H3,(H,26,31,32) |
| InChIKey | ZLBDZSUUBJAUMG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|