C20H28N6O5 — CID 16963227
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(methylamino)-5-nitrobenzamide (PubChem CID 16963227) has the molecular formula C20H28N6O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963227 |
| Molecular Formula | C20H28N6O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(methylamino)-5-nitrobenzamide |
| SMILES | CCCCN(C(=O)c1cc([N+](=O)[O-])ccc1NC)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H28N6O5/c1-4-6-10-24(16-17(21)25(11-7-5-2)20(29)23-18(16)27)19(28)14-12-13(26(30)31)8-9-15(14)22-3/h8-9,12,22H,4-7,10-11,21H2,1-3H3,(H,23,27,29) |
| InChIKey | NWYCFFJPAIPYSE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|